C20H21F2N3O2S — CID 60560118
1-[[3-[[4-(difluoromethylsulfanyl)benzoyl]amino]phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 60560118) has the molecular formula C20H21F2N3O2S and a molecular weight of 405.47 g/mol. Its IUPAC name is 1-[[3-[[4-(difluoromethylsulfanyl)benzoyl]amino]phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[[3-[[4-(difluoromethylsulfanyl)benzoyl]amino]phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 60560118 |
| Molecular Formula | C20H21F2N3O2S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 1-[[3-[[4-(difluoromethylsulfanyl)benzoyl]amino]phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1Cc1cccc(NC(=O)c2ccc(SC(F)F)cc2)c1 |
| InChI | InChI=1S/C20H21F2N3O2S/c21-20(22)28-16-8-6-14(7-9-16)19(27)24-15-4-1-3-13(11-15)12-25-10-2-5-17(25)18(23)26/h1,3-4,6-9,11,17,20H,2,5,10,12H2,(H2,23,26)(H,24,27) |
| InChIKey | DLDZOJBQRYHOLS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |