C15H19BrN2OS — CID 60560791
2-(4-bromo-2,5-dimethylphenyl)sulfanyl-N-(cyanomethyl)-N-propylacetamide (PubChem CID 60560791) has the molecular formula C15H19BrN2OS and a molecular weight of 355.30 g/mol. Its IUPAC name is 2-(4-bromo-2,5-dimethylphenyl)sulfanyl-N-(cyanomethyl)-N-propylacetamide.
| Compound Name | 2-(4-bromo-2,5-dimethylphenyl)sulfanyl-N-(cyanomethyl)-N-propylacetamide |
|---|---|
| PubChem CID | 60560791 |
| Molecular Formula | C15H19BrN2OS |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 2-(4-bromo-2,5-dimethylphenyl)sulfanyl-N-(cyanomethyl)-N-propylacetamide |
| SMILES | CCCN(CC#N)C(=O)CSc1cc(C)c(Br)cc1C |
| InChI | InChI=1S/C15H19BrN2OS/c1-4-6-18(7-5-17)15(19)10-20-14-9-11(2)13(16)8-12(14)3/h8-9H,4,6-7,10H2,1-3H3 |
| InChIKey | CTLDFSXAXQUKFH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|