C10H16N2O3 — CID 60561980
(3-methyl-1,2,4-oxadiazol-5-yl)methyl 2-ethylbutanoate (PubChem CID 60561980) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is (3-methyl-1,2,4-oxadiazol-5-yl)methyl 2-ethylbutanoate.
| Compound Name | (3-methyl-1,2,4-oxadiazol-5-yl)methyl 2-ethylbutanoate |
|---|---|
| PubChem CID | 60561980 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (3-methyl-1,2,4-oxadiazol-5-yl)methyl 2-ethylbutanoate |
| SMILES | CCC(CC)C(=O)OCc1nc(C)no1 |
| InChI | InChI=1S/C10H16N2O3/c1-4-8(5-2)10(13)14-6-9-11-7(3)12-15-9/h8H,4-6H2,1-3H3 |
| InChIKey | GRMUWHSRZAGSEA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |