About (3-carbamoylphenyl)methyl 2-ethylbutanoate
(3-carbamoylphenyl)methyl 2-ethylbutanoate (PubChem CID 60562017) has the molecular formula C14H19NO3
and a molecular weight of 249.31 g/mol. Its IUPAC name is (3-carbamoylphenyl)methyl 2-ethylbutanoate.
Molecular Properties
| Compound Name | (3-carbamoylphenyl)methyl 2-ethylbutanoate |
| PubChem CID | 60562017 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (3-carbamoylphenyl)methyl 2-ethylbutanoate |
| SMILES | CCC(CC)C(=O)OCc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C14H19NO3/c1-3-11(4-2)14(17)18-9-10-6-5-7-12(8-10)13(15)16/h5-8,11H,3-4,9H2,1-2H3,(H2,15,16) |
| InChIKey | LIICIAGHCTYUBR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-carbamoylphenyl)methyl 2-ethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-carbamoylphenyl)methyl 2-ethylbutanoate?
The IUPAC name of (3-carbamoylphenyl)methyl 2-ethylbutanoate (CID 60562017) is (3-carbamoylphenyl)methyl 2-ethylbutanoate.
What is the SMILES notation for (3-carbamoylphenyl)methyl 2-ethylbutanoate?
The canonical SMILES for (3-carbamoylphenyl)methyl 2-ethylbutanoate is CCC(CC)C(=O)OCc1cccc(C(N)=O)c1.
What is the InChIKey of (3-carbamoylphenyl)methyl 2-ethylbutanoate?
The InChIKey is LIICIAGHCTYUBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3/c1-3-11(4-2)14(17)18-9-10-6-5-7-12(8-10)13(15)16/h5-8,11H,3-4,9H2,1-2H3,(H2,15,16).
What are the key properties of (3-carbamoylphenyl)methyl 2-ethylbutanoate?
(3-carbamoylphenyl)methyl 2-ethylbutanoate has a molecular weight of 249.31 g/mol, XLogP of 2.26, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-carbamoylphenyl)methyl 2-ethylbutanoate is sourced from PubChem (CID 60562017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).