C15H17N3O3 — CID 60562435
(3-carbamoylphenyl)methyl 3-(4-methylpyrazol-1-yl)propanoate (PubChem CID 60562435) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is (3-carbamoylphenyl)methyl 3-(4-methylpyrazol-1-yl)propanoate.
| Compound Name | (3-carbamoylphenyl)methyl 3-(4-methylpyrazol-1-yl)propanoate |
|---|---|
| PubChem CID | 60562435 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (3-carbamoylphenyl)methyl 3-(4-methylpyrazol-1-yl)propanoate |
| SMILES | Cc1cnn(CCC(=O)OCc2cccc(C(N)=O)c2)c1 |
| InChI | InChI=1S/C15H17N3O3/c1-11-8-17-18(9-11)6-5-14(19)21-10-12-3-2-4-13(7-12)15(16)20/h2-4,7-9H,5-6,10H2,1H3,(H2,16,20) |
| InChIKey | HBCMIOODCFSBMX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |