C19H24N2O4S — CID 60562892
(1-benzylimidazol-2-yl)methyl 3-cyclopentylsulfonylpropanoate (PubChem CID 60562892) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is (1-benzylimidazol-2-yl)methyl 3-cyclopentylsulfonylpropanoate.
| Compound Name | (1-benzylimidazol-2-yl)methyl 3-cyclopentylsulfonylpropanoate |
|---|---|
| PubChem CID | 60562892 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (1-benzylimidazol-2-yl)methyl 3-cyclopentylsulfonylpropanoate |
| SMILES | O=C(CCS(=O)(=O)C1CCCC1)OCc1nccn1Cc1ccccc1 |
| InChI | InChI=1S/C19H24N2O4S/c22-19(10-13-26(23,24)17-8-4-5-9-17)25-15-18-20-11-12-21(18)14-16-6-2-1-3-7-16/h1-3,6-7,11-12,17H,4-5,8-10,13-15H2 |
| InChIKey | GSLLGBWIIYPGAJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |