C15H24N10 — CID 60565467
1,4-bis[(1-cyclopropyltetrazol-5-yl)methyl]-2-methylpiperazine (PubChem CID 60565467) has the molecular formula C15H24N10 and a molecular weight of 344.43 g/mol. Its IUPAC name is 1,4-bis[(1-cyclopropyltetrazol-5-yl)methyl]-2-methylpiperazine.
| Compound Name | 1,4-bis[(1-cyclopropyltetrazol-5-yl)methyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 60565467 |
| Molecular Formula | C15H24N10 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 1,4-bis[(1-cyclopropyltetrazol-5-yl)methyl]-2-methylpiperazine |
| SMILES | CC1CN(Cc2nnnn2C2CC2)CCN1Cc1nnnn1C1CC1 |
| InChI | InChI=1S/C15H24N10/c1-11-8-22(9-14-16-18-20-24(14)12-2-3-12)6-7-23(11)10-15-17-19-21-25(15)13-4-5-13/h11-13H,2-10H2,1H3 |
| InChIKey | YTBWPWVHPLDPHX-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 93.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |