C18H24N6O2 — CID 52513540
methyl 4-[(3S)-4-[(1-cyclopropyltetrazol-5-yl)methyl]-3-methylpiperazin-1-yl]benzoate (PubChem CID 52513540) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is methyl 4-[(3S)-4-[(1-cyclopropyltetrazol-5-yl)methyl]-3-methylpiperazin-1-yl]benzoate.
| Compound Name | methyl 4-[(3S)-4-[(1-cyclopropyltetrazol-5-yl)methyl]-3-methylpiperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 52513540 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | methyl 4-[(3S)-4-[(1-cyclopropyltetrazol-5-yl)methyl]-3-methylpiperazin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(Cc3nnnn3C3CC3)[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C18H24N6O2/c1-13-11-23(15-5-3-14(4-6-15)18(25)26-2)10-9-22(13)12-17-19-20-21-24(17)16-7-8-16/h3-6,13,16H,7-12H2,1-2H3/t13-/m0/s1 |
| InChIKey | WXTHLVIXDKTCGI-ZDUSSCGKSA-N |
| XLogP | 1.51 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |