C22H25N5O3 — CID 60566041
1-(4-ethylphenyl)-5-oxo-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]pyrrolidine-3-carboxamide (PubChem CID 60566041) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-5-oxo-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(4-ethylphenyl)-5-oxo-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 60566041 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 1-(4-ethylphenyl)-5-oxo-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]pyrrolidine-3-carboxamide |
| SMILES | CCc1ccc(N2CC(C(=O)NCCCn3nc4ccccn4c3=O)CC2=O)cc1 |
| InChI | InChI=1S/C22H25N5O3/c1-2-16-7-9-18(10-8-16)26-15-17(14-20(26)28)21(29)23-11-5-13-27-22(30)25-12-4-3-6-19(25)24-27/h3-4,6-10,12,17H,2,5,11,13-15H2,1H3,(H,23,29) |
| InChIKey | FUOSWWXXHHLJEV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|