C22H31N3O2S — CID 60566245
5-(2,2-dimethylpropanoylamino)-3-methyl-N-[4-(N-methylanilino)butyl]thiophene-2-carboxamide (PubChem CID 60566245) has the molecular formula C22H31N3O2S and a molecular weight of 401.58 g/mol. Its IUPAC name is 5-(2,2-dimethylpropanoylamino)-3-methyl-N-[4-(N-methylanilino)butyl]thiophene-2-carboxamide.
| Compound Name | 5-(2,2-dimethylpropanoylamino)-3-methyl-N-[4-(N-methylanilino)butyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 60566245 |
| Molecular Formula | C22H31N3O2S |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 5-(2,2-dimethylpropanoylamino)-3-methyl-N-[4-(N-methylanilino)butyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)C(C)(C)C)sc1C(=O)NCCCCN(C)c1ccccc1 |
| InChI | InChI=1S/C22H31N3O2S/c1-16-15-18(24-21(27)22(2,3)4)28-19(16)20(26)23-13-9-10-14-25(5)17-11-7-6-8-12-17/h6-8,11-12,15H,9-10,13-14H2,1-5H3,(H,23,26)(H,24,27) |
| InChIKey | QJCPUBJULVVJER-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|