C18H26F2N2OS — CID 60569241
4-(difluoromethylsulfanyl)-N-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]benzamide (PubChem CID 60569241) has the molecular formula C18H26F2N2OS and a molecular weight of 356.48 g/mol. Its IUPAC name is 4-(difluoromethylsulfanyl)-N-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]benzamide.
| Compound Name | 4-(difluoromethylsulfanyl)-N-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 60569241 |
| Molecular Formula | C18H26F2N2OS |
| Molecular Weight | 356.48 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 4-(difluoromethylsulfanyl)-N-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]benzamide |
| SMILES | CC1CCCN(C(C)(C)CNC(=O)c2ccc(SC(F)F)cc2)C1 |
| InChI | InChI=1S/C18H26F2N2OS/c1-13-5-4-10-22(11-13)18(2,3)12-21-16(23)14-6-8-15(9-7-14)24-17(19)20/h6-9,13,17H,4-5,10-12H2,1-3H3,(H,21,23) |
| InChIKey | SLTQTVMURJLKKN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |