C14H12ClN3O3 — CID 60571095
N-[2-(4-chloroanilino)-2-oxoethyl]-1-oxidopyridin-1-ium-2-carboxamide (PubChem CID 60571095) has the molecular formula C14H12ClN3O3 and a molecular weight of 305.72 g/mol. Its IUPAC name is N-[2-(4-chloroanilino)-2-oxoethyl]-1-oxidopyridin-1-ium-2-carboxamide.
| Compound Name | N-[2-(4-chloroanilino)-2-oxoethyl]-1-oxidopyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 60571095 |
| Molecular Formula | C14H12ClN3O3 |
| Molecular Weight | 305.72 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | N-[2-(4-chloroanilino)-2-oxoethyl]-1-oxidopyridin-1-ium-2-carboxamide |
| SMILES | O=C(CNC(=O)c1cccc[n+]1[O-])Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H12ClN3O3/c15-10-4-6-11(7-5-10)17-13(19)9-16-14(20)12-3-1-2-8-18(12)21/h1-8H,9H2,(H,16,20)(H,17,19) |
| InChIKey | ZAZPJIFJCYIOBE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 85.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.72 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|