C20H13Cl2F2N3O3 — CID 60572464
N-(4-amino-3,5-dichlorophenyl)-4-[(3,5-difluorobenzoyl)amino]-2-hydroxybenzamide (PubChem CID 60572464) has the molecular formula C20H13Cl2F2N3O3 and a molecular weight of 452.24 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-4-[(3,5-difluorobenzoyl)amino]-2-hydroxybenzamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-4-[(3,5-difluorobenzoyl)amino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 60572464 |
| Molecular Formula | C20H13Cl2F2N3O3 |
| Molecular Weight | 452.24 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-4-[(3,5-difluorobenzoyl)amino]-2-hydroxybenzamide |
| SMILES | Nc1c(Cl)cc(NC(=O)c2ccc(NC(=O)c3cc(F)cc(F)c3)cc2O)cc1Cl |
| InChI | InChI=1S/C20H13Cl2F2N3O3/c21-15-6-13(7-16(22)18(15)25)27-20(30)14-2-1-12(8-17(14)28)26-19(29)9-3-10(23)5-11(24)4-9/h1-8,28H,25H2,(H,26,29)(H,27,30) |
| InChIKey | BHQMPZZSHQYPNB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.24 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|