C18H23N5O3 — CID 60574074
N-[2-(azepan-1-yl)phenyl]-3-(4-nitropyrazol-1-yl)propanamide (PubChem CID 60574074) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)phenyl]-3-(4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[2-(azepan-1-yl)phenyl]-3-(4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 60574074 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N-[2-(azepan-1-yl)phenyl]-3-(4-nitropyrazol-1-yl)propanamide |
| SMILES | O=C(CCn1cc([N+](=O)[O-])cn1)Nc1ccccc1N1CCCCCC1 |
| InChI | InChI=1S/C18H23N5O3/c24-18(9-12-22-14-15(13-19-22)23(25)26)20-16-7-3-4-8-17(16)21-10-5-1-2-6-11-21/h3-4,7-8,13-14H,1-2,5-6,9-12H2,(H,20,24) |
| InChIKey | IMHQPXWRSBCPNP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|