C20H21N3O5 — CID 60575030
3,5-dinitro-N-propyl-N-(1,2,3,4-tetrahydronaphthalen-2-yl)benzamide (PubChem CID 60575030) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is 3,5-dinitro-N-propyl-N-(1,2,3,4-tetrahydronaphthalen-2-yl)benzamide.
| Compound Name | 3,5-dinitro-N-propyl-N-(1,2,3,4-tetrahydronaphthalen-2-yl)benzamide |
|---|---|
| PubChem CID | 60575030 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 3,5-dinitro-N-propyl-N-(1,2,3,4-tetrahydronaphthalen-2-yl)benzamide |
| SMILES | CCCN(C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)C1CCc2ccccc2C1 |
| InChI | InChI=1S/C20H21N3O5/c1-2-9-21(17-8-7-14-5-3-4-6-15(14)10-17)20(24)16-11-18(22(25)26)13-19(12-16)23(27)28/h3-6,11-13,17H,2,7-10H2,1H3 |
| InChIKey | FEDFWSHCUFNIPG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|