C22H20N2O3 — CID 60575299
N-[1-(1-benzofuran-2-yl)ethyl]-N-ethyl-1-oxo-2H-isoquinoline-3-carboxamide (PubChem CID 60575299) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is N-[1-(1-benzofuran-2-yl)ethyl]-N-ethyl-1-oxo-2H-isoquinoline-3-carboxamide.
| Compound Name | N-[1-(1-benzofuran-2-yl)ethyl]-N-ethyl-1-oxo-2H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 60575299 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-[1-(1-benzofuran-2-yl)ethyl]-N-ethyl-1-oxo-2H-isoquinoline-3-carboxamide |
| SMILES | CCN(C(=O)c1cc2ccccc2c(=O)[nH]1)C(C)c1cc2ccccc2o1 |
| InChI | InChI=1S/C22H20N2O3/c1-3-24(14(2)20-13-16-9-5-7-11-19(16)27-20)22(26)18-12-15-8-4-6-10-17(15)21(25)23-18/h4-14H,3H2,1-2H3,(H,23,25) |
| InChIKey | CDGYGHFDYHUDNC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 66.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |