C24H23Cl2N3O3 — CID 60577621
4-chloro-N-[4-[[2-(4-chlorophenoxy)ethyl-methylcarbamoyl]amino]phenyl]-N-methylbenzamide (PubChem CID 60577621) has the molecular formula C24H23Cl2N3O3 and a molecular weight of 472.37 g/mol. Its IUPAC name is 4-chloro-N-[4-[[2-(4-chlorophenoxy)ethyl-methylcarbamoyl]amino]phenyl]-N-methylbenzamide.
| Compound Name | 4-chloro-N-[4-[[2-(4-chlorophenoxy)ethyl-methylcarbamoyl]amino]phenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 60577621 |
| Molecular Formula | C24H23Cl2N3O3 |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 4-chloro-N-[4-[[2-(4-chlorophenoxy)ethyl-methylcarbamoyl]amino]phenyl]-N-methylbenzamide |
| SMILES | CN(CCOc1ccc(Cl)cc1)C(=O)Nc1ccc(N(C)C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H23Cl2N3O3/c1-28(15-16-32-22-13-7-19(26)8-14-22)24(31)27-20-9-11-21(12-10-20)29(2)23(30)17-3-5-18(25)6-4-17/h3-14H,15-16H2,1-2H3,(H,27,31) |
| InChIKey | ATMFTFOUBUQDPF-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |