C19H24F3NO4 — CID 60578282
N-[[1-(1,3-benzodioxol-5-yl)cyclohexyl]methyl]-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 60578282) has the molecular formula C19H24F3NO4 and a molecular weight of 387.40 g/mol. Its IUPAC name is N-[[1-(1,3-benzodioxol-5-yl)cyclohexyl]methyl]-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-[[1-(1,3-benzodioxol-5-yl)cyclohexyl]methyl]-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 60578282 |
| Molecular Formula | C19H24F3NO4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | N-[[1-(1,3-benzodioxol-5-yl)cyclohexyl]methyl]-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | O=C(CCOCC(F)(F)F)NCC1(c2ccc3c(c2)OCO3)CCCCC1 |
| InChI | InChI=1S/C19H24F3NO4/c20-19(21,22)12-25-9-6-17(24)23-11-18(7-2-1-3-8-18)14-4-5-15-16(10-14)27-13-26-15/h4-5,10H,1-3,6-9,11-13H2,(H,23,24) |
| InChIKey | ZGMQZXKRXGNISN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|