C18H24FN3O3S — CID 60579008
6-[[2-(4-fluorophenyl)-2-hydroxyethyl]amino]-N-pentan-2-ylpyridine-3-sulfonamide (PubChem CID 60579008) has the molecular formula C18H24FN3O3S and a molecular weight of 381.47 g/mol. Its IUPAC name is 6-[[2-(4-fluorophenyl)-2-hydroxyethyl]amino]-N-pentan-2-ylpyridine-3-sulfonamide.
| Compound Name | 6-[[2-(4-fluorophenyl)-2-hydroxyethyl]amino]-N-pentan-2-ylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 60579008 |
| Molecular Formula | C18H24FN3O3S |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 6-[[2-(4-fluorophenyl)-2-hydroxyethyl]amino]-N-pentan-2-ylpyridine-3-sulfonamide |
| SMILES | CCCC(C)NS(=O)(=O)c1ccc(NCC(O)c2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C18H24FN3O3S/c1-3-4-13(2)22-26(24,25)16-9-10-18(20-11-16)21-12-17(23)14-5-7-15(19)8-6-14/h5-11,13,17,22-23H,3-4,12H2,1-2H3,(H,20,21) |
| InChIKey | SSVRPFAKOBYYTO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |