C21H22ClN3O — CID 60579385
2-[[2-[(2-chlorophenyl)methyl]pyrrolidin-1-yl]methyl]-4-methylphthalazin-1-one (PubChem CID 60579385) has the molecular formula C21H22ClN3O and a molecular weight of 367.88 g/mol. Its IUPAC name is 2-[[2-[(2-chlorophenyl)methyl]pyrrolidin-1-yl]methyl]-4-methylphthalazin-1-one.
| Compound Name | 2-[[2-[(2-chlorophenyl)methyl]pyrrolidin-1-yl]methyl]-4-methylphthalazin-1-one |
|---|---|
| PubChem CID | 60579385 |
| Molecular Formula | C21H22ClN3O |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-[[2-[(2-chlorophenyl)methyl]pyrrolidin-1-yl]methyl]-4-methylphthalazin-1-one |
| SMILES | Cc1nn(CN2CCCC2Cc2ccccc2Cl)c(=O)c2ccccc12 |
| InChI | InChI=1S/C21H22ClN3O/c1-15-18-9-3-4-10-19(18)21(26)25(23-15)14-24-12-6-8-17(24)13-16-7-2-5-11-20(16)22/h2-5,7,9-11,17H,6,8,12-14H2,1H3 |
| InChIKey | WMGRLIAZWKKXBF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |