C21H25N5O2 — CID 60579425
1-benzyl-N-[6-(3-oxopiperazin-1-yl)-3-pyridinyl]pyrrolidine-2-carboxamide (PubChem CID 60579425) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-benzyl-N-[6-(3-oxopiperazin-1-yl)-3-pyridinyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-benzyl-N-[6-(3-oxopiperazin-1-yl)-3-pyridinyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 60579425 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 1-benzyl-N-[6-(3-oxopiperazin-1-yl)-3-pyridinyl]pyrrolidine-2-carboxamide |
| SMILES | O=C1CN(c2ccc(NC(=O)C3CCCN3Cc3ccccc3)cn2)CCN1 |
| InChI | InChI=1S/C21H25N5O2/c27-20-15-26(12-10-22-20)19-9-8-17(13-23-19)24-21(28)18-7-4-11-25(18)14-16-5-2-1-3-6-16/h1-3,5-6,8-9,13,18H,4,7,10-12,14-15H2,(H,22,27)(H,24,28) |
| InChIKey | JOXYXVUXKSQRNN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |