C19H21ClFN3O3 — CID 60580608
1-[3-(4-chloro-2-methylphenoxy)propyl]-3-[[2-(4-fluorophenyl)acetyl]amino]urea (PubChem CID 60580608) has the molecular formula C19H21ClFN3O3 and a molecular weight of 393.85 g/mol. Its IUPAC name is 1-[3-(4-chloro-2-methylphenoxy)propyl]-3-[[2-(4-fluorophenyl)acetyl]amino]urea.
| Compound Name | 1-[3-(4-chloro-2-methylphenoxy)propyl]-3-[[2-(4-fluorophenyl)acetyl]amino]urea |
|---|---|
| PubChem CID | 60580608 |
| Molecular Formula | C19H21ClFN3O3 |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 1-[3-(4-chloro-2-methylphenoxy)propyl]-3-[[2-(4-fluorophenyl)acetyl]amino]urea |
| SMILES | Cc1cc(Cl)ccc1OCCCNC(=O)NNC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C19H21ClFN3O3/c1-13-11-15(20)5-8-17(13)27-10-2-9-22-19(26)24-23-18(25)12-14-3-6-16(21)7-4-14/h3-8,11H,2,9-10,12H2,1H3,(H,23,25)(H2,22,24,26) |
| InChIKey | UFTBMXHDUFIBKI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|