C16H13ClF2N2O2 — CID 60581548
(6-chloro-3-pyridinyl)-[8-(difluoromethoxy)-3,4-dihydro-2H-quinolin-1-yl]methanone (PubChem CID 60581548) has the molecular formula C16H13ClF2N2O2 and a molecular weight of 338.74 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)-[8-(difluoromethoxy)-3,4-dihydro-2H-quinolin-1-yl]methanone.
| Compound Name | (6-chloro-3-pyridinyl)-[8-(difluoromethoxy)-3,4-dihydro-2H-quinolin-1-yl]methanone |
|---|---|
| PubChem CID | 60581548 |
| Molecular Formula | C16H13ClF2N2O2 |
| Molecular Weight | 338.74 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | (6-chloro-3-pyridinyl)-[8-(difluoromethoxy)-3,4-dihydro-2H-quinolin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)nc1)N1CCCc2cccc(OC(F)F)c21 |
| InChI | InChI=1S/C16H13ClF2N2O2/c17-13-7-6-11(9-20-13)15(22)21-8-2-4-10-3-1-5-12(14(10)21)23-16(18)19/h1,3,5-7,9,16H,2,4,8H2 |
| InChIKey | VEKJIYZCOJDYOA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.74 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|