C24H32N4O2 — CID 14129268
[8-[4-(4-methylpiperazin-1-yl)butoxy]-3,4-dihydro-2H-quinolin-1-yl]-pyridin-3-ylmethanone (PubChem CID 14129268) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is [8-[4-(4-methylpiperazin-1-yl)butoxy]-3,4-dihydro-2H-quinolin-1-yl]-pyridin-3-ylmethanone.
| Compound Name | [8-[4-(4-methylpiperazin-1-yl)butoxy]-3,4-dihydro-2H-quinolin-1-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 14129268 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | [8-[4-(4-methylpiperazin-1-yl)butoxy]-3,4-dihydro-2H-quinolin-1-yl]-pyridin-3-ylmethanone |
| SMILES | CN1CCN(CCCCOc2cccc3c2N(C(=O)c2cccnc2)CCC3)CC1 |
| InChI | InChI=1S/C24H32N4O2/c1-26-14-16-27(17-15-26)12-2-3-18-30-22-10-4-7-20-9-6-13-28(23(20)22)24(29)21-8-5-11-25-19-21/h4-5,7-8,10-11,19H,2-3,6,9,12-18H2,1H3 |
| InChIKey | LWCLWYCPTSTLOM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|