C21H18N2O3 — CID 60584722
2-(3-methoxy-4-methylbenzoyl)-3-(2-methyl-1H-indol-3-yl)-3-oxopropanenitrile (PubChem CID 60584722) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-(3-methoxy-4-methylbenzoyl)-3-(2-methyl-1H-indol-3-yl)-3-oxopropanenitrile.
| Compound Name | 2-(3-methoxy-4-methylbenzoyl)-3-(2-methyl-1H-indol-3-yl)-3-oxopropanenitrile |
|---|---|
| PubChem CID | 60584722 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 2-(3-methoxy-4-methylbenzoyl)-3-(2-methyl-1H-indol-3-yl)-3-oxopropanenitrile |
| SMILES | COc1cc(C(=O)C(C#N)C(=O)c2c(C)[nH]c3ccccc23)ccc1C |
| InChI | InChI=1S/C21H18N2O3/c1-12-8-9-14(10-18(12)26-3)20(24)16(11-22)21(25)19-13(2)23-17-7-5-4-6-15(17)19/h4-10,16,23H,1-3H3 |
| InChIKey | PRRYDBWELSVOSM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|