C20H14F3N3O3 — CID 98448713
(2S)-2-(2-methyl-1H-indole-3-carbonyl)-3-oxo-3-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]propanenitrile (PubChem CID 98448713) has the molecular formula C20H14F3N3O3 and a molecular weight of 401.34 g/mol. Its IUPAC name is (2S)-2-(2-methyl-1H-indole-3-carbonyl)-3-oxo-3-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]propanenitrile.
| Compound Name | (2S)-2-(2-methyl-1H-indole-3-carbonyl)-3-oxo-3-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]propanenitrile |
|---|---|
| PubChem CID | 98448713 |
| Molecular Formula | C20H14F3N3O3 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | (2S)-2-(2-methyl-1H-indole-3-carbonyl)-3-oxo-3-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]propanenitrile |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)[C@@H](C#N)C(=O)c1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C20H14F3N3O3/c1-11-17(13-4-2-3-5-15(13)26-11)19(28)14(8-24)18(27)12-6-7-16(25-9-12)29-10-20(21,22)23/h2-7,9,14,26H,10H2,1H3/t14-/m0/s1 |
| InChIKey | CZQDLSJXNHIPSS-AWEZNQCLSA-N |
| XLogP | 4.02 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|