C19H29N3O3 — CID 60586572
2-methylpropyl N-[3-[(2-methylcyclohexyl)carbamoylamino]phenyl]carbamate (PubChem CID 60586572) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-methylpropyl N-[3-[(2-methylcyclohexyl)carbamoylamino]phenyl]carbamate.
| Compound Name | 2-methylpropyl N-[3-[(2-methylcyclohexyl)carbamoylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 60586572 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 2-methylpropyl N-[3-[(2-methylcyclohexyl)carbamoylamino]phenyl]carbamate |
| SMILES | CC(C)COC(=O)Nc1cccc(NC(=O)NC2CCCCC2C)c1 |
| InChI | InChI=1S/C19H29N3O3/c1-13(2)12-25-19(24)21-16-9-6-8-15(11-16)20-18(23)22-17-10-5-4-7-14(17)3/h6,8-9,11,13-14,17H,4-5,7,10,12H2,1-3H3,(H,21,24)(H2,20,22,23) |
| InChIKey | CAMRTUJDNMATQT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |