C26H28FN3O5S — CID 6058872
4-ethoxy-N-[1-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 6058872) has the molecular formula C26H28FN3O5S and a molecular weight of 513.59 g/mol. Its IUPAC name is 4-ethoxy-N-[1-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-ethoxy-N-[1-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 6058872 |
| Molecular Formula | C26H28FN3O5S |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 4-ethoxy-N-[1-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CCOc1ccc(C(=O)NC(C(=O)NCCN2C(=O)S/C(=C\c3ccc(F)cc3)C2=O)C(C)C)cc1 |
| InChI | InChI=1S/C26H28FN3O5S/c1-4-35-20-11-7-18(8-12-20)23(31)29-22(16(2)3)24(32)28-13-14-30-25(33)21(36-26(30)34)15-17-5-9-19(27)10-6-17/h5-12,15-16,22H,4,13-14H2,1-3H3,(H,28,32)(H,29,31)/b21-15- |
| InChIKey | QCOMPRJXSOHFBX-QNGOZBTKSA-N |
| XLogP | 3.83 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|