C25H26FN3O5S — CID 55338296
N-[1-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-3-methyl-1-oxobutan-2-yl]-4-methoxybenzamide (PubChem CID 55338296) has the molecular formula C25H26FN3O5S and a molecular weight of 499.56 g/mol. Its IUPAC name is N-[1-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-3-methyl-1-oxobutan-2-yl]-4-methoxybenzamide.
| Compound Name | N-[1-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-3-methyl-1-oxobutan-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 55338296 |
| Molecular Formula | C25H26FN3O5S |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | N-[1-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-3-methyl-1-oxobutan-2-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(C(=O)NCCN2C(=O)S/C(=C\c3ccccc3F)C2=O)C(C)C)cc1 |
| InChI | InChI=1S/C25H26FN3O5S/c1-15(2)21(28-22(30)16-8-10-18(34-3)11-9-16)23(31)27-12-13-29-24(32)20(35-25(29)33)14-17-6-4-5-7-19(17)26/h4-11,14-15,21H,12-13H2,1-3H3,(H,27,31)(H,28,30)/b20-14- |
| InChIKey | KRRMILFLONWURK-ZHZULCJRSA-N |
| XLogP | 3.44 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|