C19H20BrFN2O3S — CID 60589919
1-(benzenesulfonyl)-N-[2-(5-bromo-2-fluorophenyl)ethyl]pyrrolidine-2-carboxamide (PubChem CID 60589919) has the molecular formula C19H20BrFN2O3S and a molecular weight of 455.35 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[2-(5-bromo-2-fluorophenyl)ethyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[2-(5-bromo-2-fluorophenyl)ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 60589919 |
| Molecular Formula | C19H20BrFN2O3S |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[2-(5-bromo-2-fluorophenyl)ethyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCc1cc(Br)ccc1F)C1CCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20BrFN2O3S/c20-15-8-9-17(21)14(13-15)10-11-22-19(24)18-7-4-12-23(18)27(25,26)16-5-2-1-3-6-16/h1-3,5-6,8-9,13,18H,4,7,10-12H2,(H,22,24) |
| InChIKey | FMVRWKDXBSXPGH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |