About 2-methyl-4-phenylthiane
2-methyl-4-phenylthiane (PubChem CID 605963) has the molecular formula C12H16S
and a molecular weight of 192.33 g/mol. Its IUPAC name is 2-methyl-4-phenylthiane.
Molecular Properties
| Compound Name | 2-methyl-4-phenylthiane |
| PubChem CID | 605963 |
| Molecular Formula | C12H16S |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 2-methyl-4-phenylthiane |
| SMILES | CC1CC(c2ccccc2)CCS1 |
| InChI | InChI=1S/C12H16S/c1-10-9-12(7-8-13-10)11-5-3-2-4-6-11/h2-6,10,12H,7-9H2,1H3 |
| InChIKey | BTNDCHWOHKVDLC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-4-phenylthiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-phenylthiane?
The IUPAC name of 2-methyl-4-phenylthiane (CID 605963) is 2-methyl-4-phenylthiane.
What is the SMILES notation for 2-methyl-4-phenylthiane?
The canonical SMILES for 2-methyl-4-phenylthiane is CC1CC(c2ccccc2)CCS1.
What is the InChIKey of 2-methyl-4-phenylthiane?
The InChIKey is BTNDCHWOHKVDLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16S/c1-10-9-12(7-8-13-10)11-5-3-2-4-6-11/h2-6,10,12H,7-9H2,1H3.
What are the key properties of 2-methyl-4-phenylthiane?
2-methyl-4-phenylthiane has a molecular weight of 192.33 g/mol, XLogP of 3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-phenylthiane is sourced from PubChem (CID 605963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).