C26H25F2N3O2 — CID 60598710
N-[(3,4-difluorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 60598710) has the molecular formula C26H25F2N3O2 and a molecular weight of 449.50 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 60598710 |
| Molecular Formula | C26H25F2N3O2 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | CN(C)CCN(Cc1ccc(F)c(F)c1)C(=O)Cn1c2ccccc2c(=O)c2ccccc21 |
| InChI | InChI=1S/C26H25F2N3O2/c1-29(2)13-14-30(16-18-11-12-21(27)22(28)15-18)25(32)17-31-23-9-5-3-7-19(23)26(33)20-8-4-6-10-24(20)31/h3-12,15H,13-14,16-17H2,1-2H3 |
| InChIKey | ORYHGTODAIGYSW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|