C23H28N2O4 — CID 60599656
(E)-N-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]-3-(2,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 60599656) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is (E)-N-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]-3-(2,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]-3-(2,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 60599656 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (E)-N-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]-3-(2,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(OC)c(OC)cc1/C=C/C(=O)NCCN1c2ccccc2CC1C |
| InChI | InChI=1S/C23H28N2O4/c1-16-13-17-7-5-6-8-19(17)25(16)12-11-24-23(26)10-9-18-14-21(28-3)22(29-4)15-20(18)27-2/h5-10,14-16H,11-13H2,1-4H3,(H,24,26)/b10-9+ |
| InChIKey | XTEVSEROTHUYHV-MDZDMXLPSA-N |
| XLogP | 3.29 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|