C25H21F3N4O2 — CID 60599777
N-[(3-cyanophenyl)methyl]-2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-oxo-N-prop-2-enylacetamide (PubChem CID 60599777) has the molecular formula C25H21F3N4O2 and a molecular weight of 466.46 g/mol. Its IUPAC name is N-[(3-cyanophenyl)methyl]-2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-oxo-N-prop-2-enylacetamide.
| Compound Name | N-[(3-cyanophenyl)methyl]-2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-oxo-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 60599777 |
| Molecular Formula | C25H21F3N4O2 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | N-[(3-cyanophenyl)methyl]-2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-oxo-N-prop-2-enylacetamide |
| SMILES | C=CCN(Cc1cccc(C#N)c1)C(=O)C(=O)c1c(C)nn(-c2cccc(C(F)(F)F)c2)c1C |
| InChI | InChI=1S/C25H21F3N4O2/c1-4-11-31(15-19-8-5-7-18(12-19)14-29)24(34)23(33)22-16(2)30-32(17(22)3)21-10-6-9-20(13-21)25(26,27)28/h4-10,12-13H,1,11,15H2,2-3H3 |
| InChIKey | XPKGIRHWDXQCOF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|