C15H18N2O3S — CID 60600653
ethyl 2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanylpropanoate (PubChem CID 60600653) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is ethyl 2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanylpropanoate.
| Compound Name | ethyl 2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanylpropanoate |
|---|---|
| PubChem CID | 60600653 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | ethyl 2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanylpropanoate |
| SMILES | CCOC(=O)C(C)Sc1nccn1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C15H18N2O3S/c1-4-20-14(18)11(2)21-15-16-9-10-17(15)12-5-7-13(19-3)8-6-12/h5-11H,4H2,1-3H3 |
| InChIKey | CWZRMMLYCBJNBB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |