C28H38N4O2 — CID 60602137
(Z)-N-[[4-(azepan-1-ylmethyl)phenyl]methyl]-2-cyano-3-[1-(1-methoxypropan-2-yl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide (PubChem CID 60602137) has the molecular formula C28H38N4O2 and a molecular weight of 462.64 g/mol. Its IUPAC name is (Z)-N-[[4-(azepan-1-ylmethyl)phenyl]methyl]-2-cyano-3-[1-(1-methoxypropan-2-yl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide.
| Compound Name | (Z)-N-[[4-(azepan-1-ylmethyl)phenyl]methyl]-2-cyano-3-[1-(1-methoxypropan-2-yl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 60602137 |
| Molecular Formula | C28H38N4O2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | (Z)-N-[[4-(azepan-1-ylmethyl)phenyl]methyl]-2-cyano-3-[1-(1-methoxypropan-2-yl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide |
| SMILES | COCC(C)n1c(C)cc(/C=C(/C#N)C(=O)NCc2ccc(CN3CCCCCC3)cc2)c1C |
| InChI | InChI=1S/C28H38N4O2/c1-21-15-26(23(3)32(21)22(2)20-34-4)16-27(17-29)28(33)30-18-24-9-11-25(12-10-24)19-31-13-7-5-6-8-14-31/h9-12,15-16,22H,5-8,13-14,18-20H2,1-4H3,(H,30,33)/b27-16- |
| InChIKey | USERUAGSXIFXSP-YUMHPJSZSA-N |
| XLogP | 4.91 |
| TPSA | 70.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|