C25H40N4O2 — CID 76869078
2-cyano-N-[2-(3,5-dimethylpiperidin-1-yl)-2-methylpropyl]-3-[1-(1-methoxypropan-2-yl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide (PubChem CID 76869078) has the molecular formula C25H40N4O2 and a molecular weight of 428.62 g/mol. Its IUPAC name is 2-cyano-N-[2-(3,5-dimethylpiperidin-1-yl)-2-methylpropyl]-3-[1-(1-methoxypropan-2-yl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-[2-(3,5-dimethylpiperidin-1-yl)-2-methylpropyl]-3-[1-(1-methoxypropan-2-yl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 76869078 |
| Molecular Formula | C25H40N4O2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | 2-cyano-N-[2-(3,5-dimethylpiperidin-1-yl)-2-methylpropyl]-3-[1-(1-methoxypropan-2-yl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide |
| SMILES | COCC(C)n1c(C)cc(C=C(C#N)C(=O)NCC(C)(C)N2CC(C)CC(C)C2)c1C |
| InChI | InChI=1S/C25H40N4O2/c1-17-9-18(2)14-28(13-17)25(6,7)16-27-24(30)23(12-26)11-22-10-19(3)29(21(22)5)20(4)15-31-8/h10-11,17-18,20H,9,13-16H2,1-8H3,(H,27,30) |
| InChIKey | HZJWFSOZFQORAI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 70.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|