C26H35N5O2 — CID 55634086
(Z)-2-cyano-3-[1-(1-methoxypropan-2-yl)-2,5-dimethylpyrrol-3-yl]-N-[2-(4-phenylpiperazin-1-yl)ethyl]prop-2-enamide (PubChem CID 55634086) has the molecular formula C26H35N5O2 and a molecular weight of 449.60 g/mol. Its IUPAC name is (Z)-2-cyano-3-[1-(1-methoxypropan-2-yl)-2,5-dimethylpyrrol-3-yl]-N-[2-(4-phenylpiperazin-1-yl)ethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[1-(1-methoxypropan-2-yl)-2,5-dimethylpyrrol-3-yl]-N-[2-(4-phenylpiperazin-1-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 55634086 |
| Molecular Formula | C26H35N5O2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | (Z)-2-cyano-3-[1-(1-methoxypropan-2-yl)-2,5-dimethylpyrrol-3-yl]-N-[2-(4-phenylpiperazin-1-yl)ethyl]prop-2-enamide |
| SMILES | COCC(C)n1c(C)cc(/C=C(/C#N)C(=O)NCCN2CCN(c3ccccc3)CC2)c1C |
| InChI | InChI=1S/C26H35N5O2/c1-20-16-23(22(3)31(20)21(2)19-33-4)17-24(18-27)26(32)28-10-11-29-12-14-30(15-13-29)25-8-6-5-7-9-25/h5-9,16-17,21H,10-15,19H2,1-4H3,(H,28,32)/b24-17- |
| InChIKey | BBSBTTCHHNVPIB-ULJHMMPZSA-N |
| XLogP | 3.16 |
| TPSA | 73.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|