C19H19NO4S — CID 60602780
N-(3,4-dihydronaphthalen-2-ylsulfonyl)-2-methoxy-2-phenylacetamide (PubChem CID 60602780) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is N-(3,4-dihydronaphthalen-2-ylsulfonyl)-2-methoxy-2-phenylacetamide.
| Compound Name | N-(3,4-dihydronaphthalen-2-ylsulfonyl)-2-methoxy-2-phenylacetamide |
|---|---|
| PubChem CID | 60602780 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | N-(3,4-dihydronaphthalen-2-ylsulfonyl)-2-methoxy-2-phenylacetamide |
| SMILES | COC(C(=O)NS(=O)(=O)C1=Cc2ccccc2CC1)c1ccccc1 |
| InChI | InChI=1S/C19H19NO4S/c1-24-18(15-8-3-2-4-9-15)19(21)20-25(22,23)17-12-11-14-7-5-6-10-16(14)13-17/h2-10,13,18H,11-12H2,1H3,(H,20,21) |
| InChIKey | JAQKEGYHSMITRV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |