C16H16N2O5S — CID 95300549
4-[[(2R)-2-methoxy-2-phenylacetyl]sulfamoyl]benzamide (PubChem CID 95300549) has the molecular formula C16H16N2O5S and a molecular weight of 348.38 g/mol. Its IUPAC name is 4-[[(2R)-2-methoxy-2-phenylacetyl]sulfamoyl]benzamide.
| Compound Name | 4-[[(2R)-2-methoxy-2-phenylacetyl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 95300549 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 4-[[(2R)-2-methoxy-2-phenylacetyl]sulfamoyl]benzamide |
| SMILES | CO[C@@H](C(=O)NS(=O)(=O)c1ccc(C(N)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C16H16N2O5S/c1-23-14(11-5-3-2-4-6-11)16(20)18-24(21,22)13-9-7-12(8-10-13)15(17)19/h2-10,14H,1H3,(H2,17,19)(H,18,20)/t14-/m1/s1 |
| InChIKey | DKEQFLGUAXJDHU-CQSZACIVSA-N |
| XLogP | 0.98 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |