C15H12N2O6S — CID 66586698
2-[(4-carbamoylphenyl)sulfonylcarbamoyl]benzoic acid (PubChem CID 66586698) has the molecular formula C15H12N2O6S and a molecular weight of 348.34 g/mol. Its IUPAC name is 2-[(4-carbamoylphenyl)sulfonylcarbamoyl]benzoic acid.
| Compound Name | 2-[(4-carbamoylphenyl)sulfonylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 66586698 |
| Molecular Formula | C15H12N2O6S |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 2-[(4-carbamoylphenyl)sulfonylcarbamoyl]benzoic acid |
| SMILES | NC(=O)c1ccc(S(=O)(=O)NC(=O)c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C15H12N2O6S/c16-13(18)9-5-7-10(8-6-9)24(22,23)17-14(19)11-3-1-2-4-12(11)15(20)21/h1-8H,(H2,16,18)(H,17,19)(H,20,21) |
| InChIKey | QGDOYZYOXXDRJE-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 143.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |