C16H15CaN3O7S+2 — CID 3085162
calcium 2-[[4-(hydroxymethylcarbamoylsulfamoyl)phenyl]carbamoyl]benzoic acid (PubChem CID 3085162) has the molecular formula C16H15CaN3O7S+2 and a molecular weight of 433.46 g/mol. Its IUPAC name is calcium 2-[[4-(hydroxymethylcarbamoylsulfamoyl)phenyl]carbamoyl]benzoic acid.
| Compound Name | calcium 2-[[4-(hydroxymethylcarbamoylsulfamoyl)phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 3085162 |
| Molecular Formula | C16H15CaN3O7S+2 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | calcium 2-[[4-(hydroxymethylcarbamoylsulfamoyl)phenyl]carbamoyl]benzoic acid |
| SMILES | O=C(NCO)NS(=O)(=O)c1ccc(NC(=O)c2ccccc2C(=O)O)cc1.[Ca+2] |
| InChI | InChI=1S/C16H15N3O7S.Ca/c20-9-17-16(24)19-27(25,26)11-7-5-10(6-8-11)18-14(21)12-3-1-2-4-13(12)15(22)23;/h1-8,20H,9H2,(H,18,21)(H,22,23)(H2,17,19,24);/q;+2 |
| InChIKey | CEFREMBIPGHLSW-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 161.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|