C24H26F2N2O4 — CID 60605071
N-[6-(difluoromethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-1-carboxamide (PubChem CID 60605071) has the molecular formula C24H26F2N2O4 and a molecular weight of 444.48 g/mol. Its IUPAC name is N-[6-(difluoromethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-1-carboxamide.
| Compound Name | N-[6-(difluoromethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 60605071 |
| Molecular Formula | C24H26F2N2O4 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | N-[6-(difluoromethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-1-carboxamide |
| SMILES | O=C(NC1CCCc2cc(OC(F)F)ccc21)N1CCCC1c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H26F2N2O4/c25-23(26)32-17-7-8-18-15(13-17)3-1-4-19(18)27-24(29)28-10-2-5-20(28)16-6-9-21-22(14-16)31-12-11-30-21/h6-9,13-14,19-20,23H,1-5,10-12H2,(H,27,29) |
| InChIKey | OGYFWLWZMQHADD-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |