C23H27ClN2O4 — CID 60605434
N-(2-acetamido-5-chlorophenyl)-4-oxo-4-(4-pentoxyphenyl)butanamide (PubChem CID 60605434) has the molecular formula C23H27ClN2O4 and a molecular weight of 430.93 g/mol. Its IUPAC name is N-(2-acetamido-5-chlorophenyl)-4-oxo-4-(4-pentoxyphenyl)butanamide.
| Compound Name | N-(2-acetamido-5-chlorophenyl)-4-oxo-4-(4-pentoxyphenyl)butanamide |
|---|---|
| PubChem CID | 60605434 |
| Molecular Formula | C23H27ClN2O4 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | N-(2-acetamido-5-chlorophenyl)-4-oxo-4-(4-pentoxyphenyl)butanamide |
| SMILES | CCCCCOc1ccc(C(=O)CCC(=O)Nc2cc(Cl)ccc2NC(C)=O)cc1 |
| InChI | InChI=1S/C23H27ClN2O4/c1-3-4-5-14-30-19-9-6-17(7-10-19)22(28)12-13-23(29)26-21-15-18(24)8-11-20(21)25-16(2)27/h6-11,15H,3-5,12-14H2,1-2H3,(H,25,27)(H,26,29) |
| InChIKey | UISCIAKNOSNNTA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|