C20H18N2O5S — CID 60606577
N,4-dimethyl-3-nitro-N-(2-phenoxyphenyl)benzenesulfonamide (PubChem CID 60606577) has the molecular formula C20H18N2O5S and a molecular weight of 398.44 g/mol. Its IUPAC name is N,4-dimethyl-3-nitro-N-(2-phenoxyphenyl)benzenesulfonamide.
| Compound Name | N,4-dimethyl-3-nitro-N-(2-phenoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60606577 |
| Molecular Formula | C20H18N2O5S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | N,4-dimethyl-3-nitro-N-(2-phenoxyphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2ccccc2Oc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H18N2O5S/c1-15-12-13-17(14-19(15)22(23)24)28(25,26)21(2)18-10-6-7-11-20(18)27-16-8-4-3-5-9-16/h3-14H,1-2H3 |
| InChIKey | AAIUZJQBWJKCRG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|