C18H26ClN3O3 — CID 60607073
ethyl 3-[(2-chloropyridine-4-carbonyl)-[(1-ethylpyrrolidin-2-yl)methyl]amino]propanoate (PubChem CID 60607073) has the molecular formula C18H26ClN3O3 and a molecular weight of 367.88 g/mol. Its IUPAC name is ethyl 3-[(2-chloropyridine-4-carbonyl)-[(1-ethylpyrrolidin-2-yl)methyl]amino]propanoate.
| Compound Name | ethyl 3-[(2-chloropyridine-4-carbonyl)-[(1-ethylpyrrolidin-2-yl)methyl]amino]propanoate |
|---|---|
| PubChem CID | 60607073 |
| Molecular Formula | C18H26ClN3O3 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | ethyl 3-[(2-chloropyridine-4-carbonyl)-[(1-ethylpyrrolidin-2-yl)methyl]amino]propanoate |
| SMILES | CCOC(=O)CCN(CC1CCCN1CC)C(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C18H26ClN3O3/c1-3-21-10-5-6-15(21)13-22(11-8-17(23)25-4-2)18(24)14-7-9-20-16(19)12-14/h7,9,12,15H,3-6,8,10-11,13H2,1-2H3 |
| InChIKey | NAURETVHNNBSHI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|