C20H25N5O3 — CID 60607141
N-[2-[(4-tert-butylphenyl)methyl]pyrazol-3-yl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 60607141) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-[2-[(4-tert-butylphenyl)methyl]pyrazol-3-yl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-[2-[(4-tert-butylphenyl)methyl]pyrazol-3-yl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 60607141 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-[2-[(4-tert-butylphenyl)methyl]pyrazol-3-yl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CN1CC(=O)N(CC(=O)Nc2ccnn2Cc2ccc(C(C)(C)C)cc2)C1=O |
| InChI | InChI=1S/C20H25N5O3/c1-20(2,3)15-7-5-14(6-8-15)11-25-16(9-10-21-25)22-17(26)12-24-18(27)13-23(4)19(24)28/h5-10H,11-13H2,1-4H3,(H,22,26) |
| InChIKey | OFIIIGDNGUKLSX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|