C23H26ClN3O3S — CID 34077193
N-[2-[(4-tert-butylphenyl)methyl]pyrazol-3-yl]-3-(4-chlorophenyl)sulfonylpropanamide (PubChem CID 34077193) has the molecular formula C23H26ClN3O3S and a molecular weight of 460.00 g/mol. Its IUPAC name is N-[2-[(4-tert-butylphenyl)methyl]pyrazol-3-yl]-3-(4-chlorophenyl)sulfonylpropanamide.
| Compound Name | N-[2-[(4-tert-butylphenyl)methyl]pyrazol-3-yl]-3-(4-chlorophenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 34077193 |
| Molecular Formula | C23H26ClN3O3S |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | N-[2-[(4-tert-butylphenyl)methyl]pyrazol-3-yl]-3-(4-chlorophenyl)sulfonylpropanamide |
| SMILES | CC(C)(C)c1ccc(Cn2nccc2NC(=O)CCS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H26ClN3O3S/c1-23(2,3)18-6-4-17(5-7-18)16-27-21(12-14-25-27)26-22(28)13-15-31(29,30)20-10-8-19(24)9-11-20/h4-12,14H,13,15-16H2,1-3H3,(H,26,28) |
| InChIKey | RGVCFRLPNYJCGS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |