C24H29N3O3S — CID 55555165
N-(1-benzyl-3-tert-butylpyrazol-5-yl)-3-(4-methylphenyl)sulfonylpropanamide (PubChem CID 55555165) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is N-(1-benzyl-3-tert-butylpyrazol-5-yl)-3-(4-methylphenyl)sulfonylpropanamide.
| Compound Name | N-(1-benzyl-3-tert-butylpyrazol-5-yl)-3-(4-methylphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 55555165 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-(1-benzyl-3-tert-butylpyrazol-5-yl)-3-(4-methylphenyl)sulfonylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)Nc2cc(C(C)(C)C)nn2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H29N3O3S/c1-18-10-12-20(13-11-18)31(29,30)15-14-23(28)25-22-16-21(24(2,3)4)26-27(22)17-19-8-6-5-7-9-19/h5-13,16H,14-15,17H2,1-4H3,(H,25,28) |
| InChIKey | HELYJCMPHZBSHN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |