C21H23BrN4O3 — CID 112813566
N-[2-[(1-benzyl-3-tert-butylpyrazol-5-yl)amino]-2-oxoethyl]-5-bromofuran-2-carboxamide (PubChem CID 112813566) has the molecular formula C21H23BrN4O3 and a molecular weight of 459.34 g/mol. Its IUPAC name is N-[2-[(1-benzyl-3-tert-butylpyrazol-5-yl)amino]-2-oxoethyl]-5-bromofuran-2-carboxamide.
| Compound Name | N-[2-[(1-benzyl-3-tert-butylpyrazol-5-yl)amino]-2-oxoethyl]-5-bromofuran-2-carboxamide |
|---|---|
| PubChem CID | 112813566 |
| Molecular Formula | C21H23BrN4O3 |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | N-[2-[(1-benzyl-3-tert-butylpyrazol-5-yl)amino]-2-oxoethyl]-5-bromofuran-2-carboxamide |
| SMILES | CC(C)(C)c1cc(NC(=O)CNC(=O)c2ccc(Br)o2)n(Cc2ccccc2)n1 |
| InChI | InChI=1S/C21H23BrN4O3/c1-21(2,3)16-11-18(26(25-16)13-14-7-5-4-6-8-14)24-19(27)12-23-20(28)15-9-10-17(22)29-15/h4-11H,12-13H2,1-3H3,(H,23,28)(H,24,27) |
| InChIKey | BLHUAZXZDPJFHJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |